C19H24N4O2 — CID 174645598
(E)-N-hydroxy-3-[4-[(3S)-4-imino-6-(5-methylpyrazol-1-yl)hexan-3-yl]phenyl]prop-2-enamide (PubChem CID 174645598) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[(3S)-4-imino-6-(5-methylpyrazol-1-yl)hexan-3-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[(3S)-4-imino-6-(5-methylpyrazol-1-yl)hexan-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 174645598 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[(3S)-4-imino-6-(5-methylpyrazol-1-yl)hexan-3-yl]phenyl]prop-2-enamide |
| SMILES | [H]/N=C(\CCn1nccc1C)[C@@H](CC)c1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-3-17(18(20)11-13-23-14(2)10-12-21-23)16-7-4-15(5-8-16)6-9-19(24)22-25/h4-10,12,17,20,25H,3,11,13H2,1-2H3,(H,22,24)/b9-6+,20-18+/t17-/m0/s1 |
| InChIKey | TZDOGGGOWFDGOF-ULGQVZKISA-N |
| XLogP | 3.31 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|