C16H22N2O4S — CID 174647506
1-[3-[4-(aminomethyl)phenyl]prop-2-enylsulfonyl]piperidine-4-carboxylic acid (PubChem CID 174647506) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[3-[4-(aminomethyl)phenyl]prop-2-enylsulfonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[4-(aminomethyl)phenyl]prop-2-enylsulfonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174647506 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[3-[4-(aminomethyl)phenyl]prop-2-enylsulfonyl]piperidine-4-carboxylic acid |
| SMILES | NCc1ccc(C=CCS(=O)(=O)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c17-12-14-5-3-13(4-6-14)2-1-11-23(21,22)18-9-7-15(8-10-18)16(19)20/h1-6,15H,7-12,17H2,(H,19,20) |
| InChIKey | ZBOXKJYIDVDBIO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |