C45H48N6O3S2 — CID 174647753
2,4-bis[(2R)-2-[2-(6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one (PubChem CID 174647753) has the molecular formula C45H48N6O3S2 and a molecular weight of 785.05 g/mol. Its IUPAC name is 2,4-bis[(2R)-2-[2-(6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one.
| Compound Name | 2,4-bis[(2R)-2-[2-(6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
|---|---|
| PubChem CID | 174647753 |
| Molecular Formula | C45H48N6O3S2 |
| Molecular Weight | 785.05 g/mol |
| Exact Mass | 784.32 |
| IUPAC Name | 2,4-bis[(2R)-2-[2-(6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
| SMILES | Cc1ccc(-c2nc([C@H]3CCCCN3C(COc3ccccc3)C(=O)C(COc3ccccc3)N3CCCC[C@@H]3c3csc(-c4ccc(C)nc4)n3)cs2)cn1 |
| InChI | InChI=1S/C45H48N6O3S2/c1-31-19-21-33(25-46-31)44-48-37(29-55-44)39-17-9-11-23-50(39)41(27-53-35-13-5-3-6-14-35)43(52)42(28-54-36-15-7-4-8-16-36)51-24-12-10-18-40(51)38-30-56-45(49-38)34-22-20-32(2)47-26-34/h3-8,13-16,19-22,25-26,29-30,39-42H,9-12,17-18,23-24,27-28H2,1-2H3/t39-,40-,41?,42?/m1/s1 |
| InChIKey | CUMVIFHTAUHGOL-PPSFMLEKSA-N |
| XLogP | 9.56 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.05 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |