C16H19ClN2O2S — CID 17464793
ethyl 4-(4-chlorophenyl)-1,3,5-trimethyl-2-sulfanylidene-4H-pyrimidine-6-carboxylate (PubChem CID 17464793) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-1,3,5-trimethyl-2-sulfanylidene-4H-pyrimidine-6-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-1,3,5-trimethyl-2-sulfanylidene-4H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 17464793 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-1,3,5-trimethyl-2-sulfanylidene-4H-pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C(c2ccc(Cl)cc2)N(C)C(=S)N1C |
| InChI | InChI=1S/C16H19ClN2O2S/c1-5-21-15(20)14-10(2)13(18(3)16(22)19(14)4)11-6-8-12(17)9-7-11/h6-9,13H,5H2,1-4H3 |
| InChIKey | ZSQLWNDLBYNFMU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|