C29H35ClN2O4 — CID 71675639
diethyl 4-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 71675639) has the molecular formula C29H35ClN2O4 and a molecular weight of 511.06 g/mol. Its IUPAC name is diethyl 4-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 71675639 |
| Molecular Formula | C29H35ClN2O4 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | diethyl 4-(4-chlorophenyl)-1-[4-(diethylamino)phenyl]-2,6-dimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(N(CC)CC)cc2)C(C)=C(C(=O)OCC)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H35ClN2O4/c1-7-31(8-2)23-15-17-24(18-16-23)32-19(5)25(28(33)35-9-3)27(21-11-13-22(30)14-12-21)26(20(32)6)29(34)36-10-4/h11-18,27H,7-10H2,1-6H3 |
| InChIKey | GZDTTYGSPHRJSM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|