About (3-iodophenyl) dihydrogen phosphite
(3-iodophenyl) dihydrogen phosphite (PubChem CID 174648122) has the molecular formula C6H6IO3P
and a molecular weight of 283.99 g/mol. Its IUPAC name is (3-iodophenyl) dihydrogen phosphite.
Molecular Properties
| Compound Name | (3-iodophenyl) dihydrogen phosphite |
| PubChem CID | 174648122 |
| Molecular Formula | C6H6IO3P |
| Molecular Weight | 283.99 g/mol |
| Exact Mass | 283.91 |
| IUPAC Name | (3-iodophenyl) dihydrogen phosphite |
| SMILES | OP(O)Oc1cccc(I)c1 |
| InChI | InChI=1S/C6H6IO3P/c7-5-2-1-3-6(4-5)10-11(8)9/h1-4,8-9H |
| InChIKey | DBDXFFKLFMEMGG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.99 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl) dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl) dihydrogen phosphite?
The IUPAC name of (3-iodophenyl) dihydrogen phosphite (CID 174648122) is (3-iodophenyl) dihydrogen phosphite.
What is the SMILES notation for (3-iodophenyl) dihydrogen phosphite?
The canonical SMILES for (3-iodophenyl) dihydrogen phosphite is OP(O)Oc1cccc(I)c1.
What is the InChIKey of (3-iodophenyl) dihydrogen phosphite?
The InChIKey is DBDXFFKLFMEMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IO3P/c7-5-2-1-3-6(4-5)10-11(8)9/h1-4,8-9H.
What are the key properties of (3-iodophenyl) dihydrogen phosphite?
(3-iodophenyl) dihydrogen phosphite has a molecular weight of 283.99 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl) dihydrogen phosphite is sourced from PubChem (CID 174648122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).