C19H14F2N6O2 — CID 174649264
N-[3-fluoro-2-[4-[(6-fluoro-7-hydroxyquinazolin-4-yl)amino]pyrazol-1-yl]phenyl]acetamide (PubChem CID 174649264) has the molecular formula C19H14F2N6O2 and a molecular weight of 396.36 g/mol. Its IUPAC name is N-[3-fluoro-2-[4-[(6-fluoro-7-hydroxyquinazolin-4-yl)amino]pyrazol-1-yl]phenyl]acetamide.
| Compound Name | N-[3-fluoro-2-[4-[(6-fluoro-7-hydroxyquinazolin-4-yl)amino]pyrazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 174649264 |
| Molecular Formula | C19H14F2N6O2 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-fluoro-2-[4-[(6-fluoro-7-hydroxyquinazolin-4-yl)amino]pyrazol-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(F)c1-n1cc(Nc2ncnc3cc(O)c(F)cc23)cn1 |
| InChI | InChI=1S/C19H14F2N6O2/c1-10(28)25-15-4-2-3-13(20)18(15)27-8-11(7-24-27)26-19-12-5-14(21)17(29)6-16(12)22-9-23-19/h2-9,29H,1H3,(H,25,28)(H,22,23,26) |
| InChIKey | YFQSPIOUVIRPBE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |