About 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol
8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol (PubChem CID 174649569) has the molecular formula C23H42N2O2
and a molecular weight of 378.60 g/mol. Its IUPAC name is 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol.
Molecular Properties
| Compound Name | 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol |
| PubChem CID | 174649569 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol |
| SMILES | CC(C)(C)c1ccc(O)cc1C(C)(C)C.CCC(=O)C(C)CCCC(N)N |
| InChI | InChI=1S/C14H22O.C9H20N2O/c1-13(2,3)11-8-7-10(15)9-12(11)14(4,5)6;1-3-8(12)7(2)5-4-6-9(10)11/h7-9,15H,1-6H3;7,9H,3-6,10-11H2,1-2H3 |
| InChIKey | MLMFANKIYJDYMX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol?
The IUPAC name of 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol (CID 174649569) is 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol.
What is the SMILES notation for 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol?
The canonical SMILES for 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol is CC(C)(C)c1ccc(O)cc1C(C)(C)C.CCC(=O)C(C)CCCC(N)N.
What is the InChIKey of 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol?
The InChIKey is MLMFANKIYJDYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C9H20N2O/c1-13(2,3)11-8-7-10(15)9-12(11)14(4,5)6;1-3-8(12)7(2)5-4-6-9(10)11/h7-9,15H,1-6H3;7,9H,3-6,10-11H2,1-2H3.
What are the key properties of 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol?
8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol has a molecular weight of 378.60 g/mol, XLogP of 5.00, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-diamino-4-methyloctan-3-one;3,4-ditert-butylphenol is sourced from PubChem (CID 174649569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).