C13H17ClO2 — CID 175601429
3-(2-tert-butyl-4-hydroxyphenyl)propanoyl chloride (PubChem CID 175601429) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 3-(2-tert-butyl-4-hydroxyphenyl)propanoyl chloride.
| Compound Name | 3-(2-tert-butyl-4-hydroxyphenyl)propanoyl chloride |
|---|---|
| PubChem CID | 175601429 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-(2-tert-butyl-4-hydroxyphenyl)propanoyl chloride |
| SMILES | CC(C)(C)c1cc(O)ccc1CCC(=O)Cl |
| InChI | InChI=1S/C13H17ClO2/c1-13(2,3)11-8-10(15)6-4-9(11)5-7-12(14)16/h4,6,8,15H,5,7H2,1-3H3 |
| InChIKey | BWOYZOFYEWMBRX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|