C12H14O4 — CID 174651505
acetyl 2-(4-hydroxy-4-methylcyclohexa-2,5-dien-1-ylidene)propanoate (PubChem CID 174651505) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is acetyl 2-(4-hydroxy-4-methylcyclohexa-2,5-dien-1-ylidene)propanoate.
| Compound Name | acetyl 2-(4-hydroxy-4-methylcyclohexa-2,5-dien-1-ylidene)propanoate |
|---|---|
| PubChem CID | 174651505 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | acetyl 2-(4-hydroxy-4-methylcyclohexa-2,5-dien-1-ylidene)propanoate |
| SMILES | CC(=O)OC(=O)C(C)=C1C=CC(C)(O)C=C1 |
| InChI | InChI=1S/C12H14O4/c1-8(11(14)16-9(2)13)10-4-6-12(3,15)7-5-10/h4-7,15H,1-3H3/b10-8- |
| InChIKey | UOQYBCAELZLVBN-NTMALXAHSA-N |
| XLogP | 1.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|