C16H16ClN5O4 — CID 174651843
3-chloro-4-methoxy-N-(5-nitro-2-pyrrolidin-1-ylpyrimidin-4-yl)benzamide (PubChem CID 174651843) has the molecular formula C16H16ClN5O4 and a molecular weight of 377.79 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-(5-nitro-2-pyrrolidin-1-ylpyrimidin-4-yl)benzamide.
| Compound Name | 3-chloro-4-methoxy-N-(5-nitro-2-pyrrolidin-1-ylpyrimidin-4-yl)benzamide |
|---|---|
| PubChem CID | 174651843 |
| Molecular Formula | C16H16ClN5O4 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-chloro-4-methoxy-N-(5-nitro-2-pyrrolidin-1-ylpyrimidin-4-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(N3CCCC3)ncc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C16H16ClN5O4/c1-26-13-5-4-10(8-11(13)17)15(23)19-14-12(22(24)25)9-18-16(20-14)21-6-2-3-7-21/h4-5,8-9H,2-3,6-7H2,1H3,(H,18,19,20,23) |
| InChIKey | CVTIVXHWOZZNRQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|