C16H16N2O4Ru — CID 174651960
diethyl 2-pyridin-2-ylpyridine-3,4-dicarboxylate;ruthenium (PubChem CID 174651960) has the molecular formula C16H16N2O4Ru and a molecular weight of 401.38 g/mol. Its IUPAC name is diethyl 2-pyridin-2-ylpyridine-3,4-dicarboxylate;ruthenium.
| Compound Name | diethyl 2-pyridin-2-ylpyridine-3,4-dicarboxylate;ruthenium |
|---|---|
| PubChem CID | 174651960 |
| Molecular Formula | C16H16N2O4Ru |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | diethyl 2-pyridin-2-ylpyridine-3,4-dicarboxylate;ruthenium |
| SMILES | CCOC(=O)c1ccnc(-c2ccccn2)c1C(=O)OCC.[Ru] |
| InChI | InChI=1S/C16H16N2O4.Ru/c1-3-21-15(19)11-8-10-18-14(12-7-5-6-9-17-12)13(11)16(20)22-4-2;/h5-10H,3-4H2,1-2H3; |
| InChIKey | UETVNTUIZQPNIC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |