C12H6Cl2N2O2 — CID 87501484
2-pyridin-2-ylpyridine-3,4-dicarbonyl chloride (PubChem CID 87501484) has the molecular formula C12H6Cl2N2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine-3,4-dicarbonyl chloride.
| Compound Name | 2-pyridin-2-ylpyridine-3,4-dicarbonyl chloride |
|---|---|
| PubChem CID | 87501484 |
| Molecular Formula | C12H6Cl2N2O2 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2-pyridin-2-ylpyridine-3,4-dicarbonyl chloride |
| SMILES | O=C(Cl)c1ccnc(-c2ccccn2)c1C(=O)Cl |
| InChI | InChI=1S/C12H6Cl2N2O2/c13-11(17)7-4-6-16-10(9(7)12(14)18)8-3-1-2-5-15-8/h1-6H |
| InChIKey | AAKVBNWOXSBLAR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|