C14H16INO6 — CID 174652789
(2R,3R,4R,5R,6S)-6-(hydroxymethyl)-4-(1H-indol-2-yl)-6-iodooxane-2,3,4,5-tetrol (PubChem CID 174652789) has the molecular formula C14H16INO6 and a molecular weight of 421.19 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-6-(hydroxymethyl)-4-(1H-indol-2-yl)-6-iodooxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R,6S)-6-(hydroxymethyl)-4-(1H-indol-2-yl)-6-iodooxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 174652789 |
| Molecular Formula | C14H16INO6 |
| Molecular Weight | 421.19 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | (2R,3R,4R,5R,6S)-6-(hydroxymethyl)-4-(1H-indol-2-yl)-6-iodooxane-2,3,4,5-tetrol |
| SMILES | OC[C@@]1(I)O[C@@H](O)[C@H](O)[C@](O)(c2cc3ccccc3[nH]2)[C@H]1O |
| InChI | InChI=1S/C14H16INO6/c15-13(6-17)12(20)14(21,10(18)11(19)22-13)9-5-7-3-1-2-4-8(7)16-9/h1-5,10-12,16-21H,6H2/t10-,11+,12-,13+,14+/m0/s1 |
| InChIKey | UFQCQLOYGMYZPI-MEBFFEOJSA-N |
| XLogP | -0.45 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.19 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|