C10H22N2O3 — CID 174652881
tert-butyl N-[(4-hydroxy-3-methylbutan-2-yl)amino]carbamate (PubChem CID 174652881) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is tert-butyl N-[(4-hydroxy-3-methylbutan-2-yl)amino]carbamate.
| Compound Name | tert-butyl N-[(4-hydroxy-3-methylbutan-2-yl)amino]carbamate |
|---|---|
| PubChem CID | 174652881 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | tert-butyl N-[(4-hydroxy-3-methylbutan-2-yl)amino]carbamate |
| SMILES | CC(CO)C(C)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H22N2O3/c1-7(6-13)8(2)11-12-9(14)15-10(3,4)5/h7-8,11,13H,6H2,1-5H3,(H,12,14) |
| InChIKey | PHIBDXHZKMSNEV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|