C8H17N3O4 — CID 130003468
tert-butyl N-[(2-amino-3-hydroxypropanoyl)amino]carbamate (PubChem CID 130003468) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is tert-butyl N-[(2-amino-3-hydroxypropanoyl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-amino-3-hydroxypropanoyl)amino]carbamate |
|---|---|
| PubChem CID | 130003468 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | tert-butyl N-[(2-amino-3-hydroxypropanoyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)C(N)CO |
| InChI | InChI=1S/C8H17N3O4/c1-8(2,3)15-7(14)11-10-6(13)5(9)4-12/h5,12H,4,9H2,1-3H3,(H,10,13)(H,11,14) |
| InChIKey | DDNMURQSIGVQAJ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|