C7H10N2O4P+ — CID 174655051
(6-amino-5-methoxy-3-pyridinyl)methoxy-hydroxy-oxophosphanium (PubChem CID 174655051) has the molecular formula C7H10N2O4P+ and a molecular weight of 217.14 g/mol. Its IUPAC name is (6-amino-5-methoxy-3-pyridinyl)methoxy-hydroxy-oxophosphanium.
| Compound Name | (6-amino-5-methoxy-3-pyridinyl)methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 174655051 |
| Molecular Formula | C7H10N2O4P+ |
| Molecular Weight | 217.14 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (6-amino-5-methoxy-3-pyridinyl)methoxy-hydroxy-oxophosphanium |
| SMILES | COc1cc(CO[P+](=O)O)cnc1N |
| InChI | InChI=1S/C7H9N2O4P/c1-12-6-2-5(3-9-7(6)8)4-13-14(10)11/h2-3H,4H2,1H3,(H2-,8,9,10,11)/p+1 |
| InChIKey | MSHYZLAFBUIUHJ-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.14 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|