C25H26N6O3 — CID 174656074
7-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-9-methyl-2-phenyl-8H-purine-8-carbaldehyde (PubChem CID 174656074) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 7-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-9-methyl-2-phenyl-8H-purine-8-carbaldehyde.
| Compound Name | 7-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-9-methyl-2-phenyl-8H-purine-8-carbaldehyde |
|---|---|
| PubChem CID | 174656074 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 7-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-9-methyl-2-phenyl-8H-purine-8-carbaldehyde |
| SMILES | COc1ccccc1N1CCN(C(=O)N2c3cnc(-c4ccccc4)nc3N(C)C2C=O)CC1 |
| InChI | InChI=1S/C25H26N6O3/c1-28-22(17-32)31(20-16-26-23(27-24(20)28)18-8-4-3-5-9-18)25(33)30-14-12-29(13-15-30)19-10-6-7-11-21(19)34-2/h3-11,16-17,22H,12-15H2,1-2H3 |
| InChIKey | RUSDXACOXSLPNZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|