C17H17N5O2 — CID 175295136
2-phenyl-7-(pyrrolidine-1-carbonyl)-8,9-dihydropurine-8-carbaldehyde (PubChem CID 175295136) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-phenyl-7-(pyrrolidine-1-carbonyl)-8,9-dihydropurine-8-carbaldehyde.
| Compound Name | 2-phenyl-7-(pyrrolidine-1-carbonyl)-8,9-dihydropurine-8-carbaldehyde |
|---|---|
| PubChem CID | 175295136 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-phenyl-7-(pyrrolidine-1-carbonyl)-8,9-dihydropurine-8-carbaldehyde |
| SMILES | O=CC1Nc2nc(-c3ccccc3)ncc2N1C(=O)N1CCCC1 |
| InChI | InChI=1S/C17H17N5O2/c23-11-14-19-16-13(22(14)17(24)21-8-4-5-9-21)10-18-15(20-16)12-6-2-1-3-7-12/h1-3,6-7,10-11,14H,4-5,8-9H2,(H,18,19,20) |
| InChIKey | XQKWUNWSYHSONU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|