C23H24N4O — CID 160545765
cyclopropyl-[3-[4-(2-phenylpyrimidin-5-yl)-3H-pyrrol-2-yl]piperidin-1-yl]methanone (PubChem CID 160545765) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is cyclopropyl-[3-[4-(2-phenylpyrimidin-5-yl)-3H-pyrrol-2-yl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[3-[4-(2-phenylpyrimidin-5-yl)-3H-pyrrol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 160545765 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | cyclopropyl-[3-[4-(2-phenylpyrimidin-5-yl)-3H-pyrrol-2-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCCC(C2=NC=C(c3cnc(-c4ccccc4)nc3)C2)C1 |
| InChI | InChI=1S/C23H24N4O/c28-23(17-8-9-17)27-10-4-7-18(15-27)21-11-19(12-24-21)20-13-25-22(26-14-20)16-5-2-1-3-6-16/h1-3,5-6,12-14,17-18H,4,7-11,15H2 |
| InChIKey | QXKGFNGCRGEJBH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |