C24H29N5O2 — CID 56537293
cyclopropyl-[3-[4-(2-phenylpyrimidin-4-yl)piperazine-1-carbonyl]piperidin-1-yl]methanone (PubChem CID 56537293) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is cyclopropyl-[3-[4-(2-phenylpyrimidin-4-yl)piperazine-1-carbonyl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[3-[4-(2-phenylpyrimidin-4-yl)piperazine-1-carbonyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 56537293 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | cyclopropyl-[3-[4-(2-phenylpyrimidin-4-yl)piperazine-1-carbonyl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCN(C(=O)C2CC2)C1)N1CCN(c2ccnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H29N5O2/c30-23(19-8-9-19)29-12-4-7-20(17-29)24(31)28-15-13-27(14-16-28)21-10-11-25-22(26-21)18-5-2-1-3-6-18/h1-3,5-6,10-11,19-20H,4,7-9,12-17H2 |
| InChIKey | HETBGEURYGYJDI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |