C41H26O8 — CID 174656697
3-[4-[9-[4-(2,3-dicarboxyphenyl)phenyl]fluoren-9-yl]phenyl]phthalic acid (PubChem CID 174656697) has the molecular formula C41H26O8 and a molecular weight of 646.65 g/mol. Its IUPAC name is 3-[4-[9-[4-(2,3-dicarboxyphenyl)phenyl]fluoren-9-yl]phenyl]phthalic acid.
| Compound Name | 3-[4-[9-[4-(2,3-dicarboxyphenyl)phenyl]fluoren-9-yl]phenyl]phthalic acid |
|---|---|
| PubChem CID | 174656697 |
| Molecular Formula | C41H26O8 |
| Molecular Weight | 646.65 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | 3-[4-[9-[4-(2,3-dicarboxyphenyl)phenyl]fluoren-9-yl]phenyl]phthalic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(C3(c4ccc(-c5cccc(C(=O)O)c5C(=O)O)cc4)c4ccccc4-c4ccccc43)cc2)c1C(=O)O |
| InChI | InChI=1S/C41H26O8/c42-37(43)31-11-5-9-27(35(31)39(46)47)23-15-19-25(20-16-23)41(33-13-3-1-7-29(33)30-8-2-4-14-34(30)41)26-21-17-24(18-22-26)28-10-6-12-32(38(44)45)36(28)40(48)49/h1-22H,(H,42,43)(H,44,45)(H,46,47)(H,48,49) |
| InChIKey | MHSOGPJGNVHBHO-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.65 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |