About methyl 3-chloropropanoate;sulfurous acid
methyl 3-chloropropanoate;sulfurous acid (PubChem CID 174657219) has the molecular formula C4H9ClO5S
and a molecular weight of 204.63 g/mol. Its IUPAC name is methyl 3-chloropropanoate;sulfurous acid.
Molecular Properties
| Compound Name | methyl 3-chloropropanoate;sulfurous acid |
| PubChem CID | 174657219 |
| Molecular Formula | C4H9ClO5S |
| Molecular Weight | 204.63 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | methyl 3-chloropropanoate;sulfurous acid |
| SMILES | COC(=O)CCCl.O=S(O)O |
| InChI | InChI=1S/C4H7ClO2.H2O3S/c1-7-4(6)2-3-5;1-4(2)3/h2-3H2,1H3;(H2,1,2,3) |
| InChIKey | QQKFDFOJYIXPQY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.63 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-chloropropanoate;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloropropanoate;sulfurous acid?
The IUPAC name of methyl 3-chloropropanoate;sulfurous acid (CID 174657219) is methyl 3-chloropropanoate;sulfurous acid.
What is the SMILES notation for methyl 3-chloropropanoate;sulfurous acid?
The canonical SMILES for methyl 3-chloropropanoate;sulfurous acid is COC(=O)CCCl.O=S(O)O.
What is the InChIKey of methyl 3-chloropropanoate;sulfurous acid?
The InChIKey is QQKFDFOJYIXPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO2.H2O3S/c1-7-4(6)2-3-5;1-4(2)3/h2-3H2,1H3;(H2,1,2,3).
What are the key properties of methyl 3-chloropropanoate;sulfurous acid?
methyl 3-chloropropanoate;sulfurous acid has a molecular weight of 204.63 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloropropanoate;sulfurous acid is sourced from PubChem (CID 174657219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).