C13H24F2O2S — CID 174660175
[1-(7,7-difluoroheptylsulfanyl)-2-methylpropyl] acetate (PubChem CID 174660175) has the molecular formula C13H24F2O2S and a molecular weight of 282.40 g/mol. Its IUPAC name is [1-(7,7-difluoroheptylsulfanyl)-2-methylpropyl] acetate.
| Compound Name | [1-(7,7-difluoroheptylsulfanyl)-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 174660175 |
| Molecular Formula | C13H24F2O2S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | [1-(7,7-difluoroheptylsulfanyl)-2-methylpropyl] acetate |
| SMILES | CC(=O)OC(SCCCCCCC(F)F)C(C)C |
| InChI | InChI=1S/C13H24F2O2S/c1-10(2)13(17-11(3)16)18-9-7-5-4-6-8-12(14)15/h10,12-13H,4-9H2,1-3H3 |
| InChIKey | NVHPIFFFFVKZES-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|