About 1-quinoxalin-2-ylethyl formate
1-quinoxalin-2-ylethyl formate (PubChem CID 174662110) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 1-quinoxalin-2-ylethyl formate.
Molecular Properties
| Compound Name | 1-quinoxalin-2-ylethyl formate |
| PubChem CID | 174662110 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 1-quinoxalin-2-ylethyl formate |
| SMILES | CC(OC=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C11H10N2O2/c1-8(15-7-14)11-6-12-9-4-2-3-5-10(9)13-11/h2-8H,1H3 |
| InChIKey | OFHNPRLCEIPQIU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-quinoxalin-2-ylethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-quinoxalin-2-ylethyl formate?
The IUPAC name of 1-quinoxalin-2-ylethyl formate (CID 174662110) is 1-quinoxalin-2-ylethyl formate.
What is the SMILES notation for 1-quinoxalin-2-ylethyl formate?
The canonical SMILES for 1-quinoxalin-2-ylethyl formate is CC(OC=O)c1cnc2ccccc2n1.
What is the InChIKey of 1-quinoxalin-2-ylethyl formate?
The InChIKey is OFHNPRLCEIPQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-8(15-7-14)11-6-12-9-4-2-3-5-10(9)13-11/h2-8H,1H3.
What are the key properties of 1-quinoxalin-2-ylethyl formate?
1-quinoxalin-2-ylethyl formate has a molecular weight of 202.21 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-quinoxalin-2-ylethyl formate is sourced from PubChem (CID 174662110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).