C19H18N4O3 — CID 174662219
5-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)pyrazine-2-carboxamide (PubChem CID 174662219) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174662219 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 5-(3-aminophenyl)-N-(3,4-dimethoxyphenyl)pyrazine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc(-c3cccc(N)c3)cn2)cc1OC |
| InChI | InChI=1S/C19H18N4O3/c1-25-17-7-6-14(9-18(17)26-2)23-19(24)16-11-21-15(10-22-16)12-4-3-5-13(20)8-12/h3-11H,20H2,1-2H3,(H,23,24) |
| InChIKey | OBHHWYZBKRBKRB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|