C21H25FN4O2 — CID 174662602
7-ethyl-2-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-8-propan-2-yl-6,7-dihydropteridine-6-carbaldehyde (PubChem CID 174662602) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is 7-ethyl-2-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-8-propan-2-yl-6,7-dihydropteridine-6-carbaldehyde.
| Compound Name | 7-ethyl-2-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-8-propan-2-yl-6,7-dihydropteridine-6-carbaldehyde |
|---|---|
| PubChem CID | 174662602 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 7-ethyl-2-[2-(4-fluorophenyl)-2-oxoethyl]-5-methyl-8-propan-2-yl-6,7-dihydropteridine-6-carbaldehyde |
| SMILES | CCC1C(C=O)N(C)c2cnc(CC(=O)c3ccc(F)cc3)nc2N1C(C)C |
| InChI | InChI=1S/C21H25FN4O2/c1-5-16-18(12-27)25(4)17-11-23-20(24-21(17)26(16)13(2)3)10-19(28)14-6-8-15(22)9-7-14/h6-9,11-13,16,18H,5,10H2,1-4H3 |
| InChIKey | NVXJXSIBCQPWIL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|