C14H13FN2O — CID 123157976
2-(4,5-dimethylpyrimidin-2-yl)-1-(4-fluorophenyl)ethanone (PubChem CID 123157976) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-(4,5-dimethylpyrimidin-2-yl)-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-(4,5-dimethylpyrimidin-2-yl)-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 123157976 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(4,5-dimethylpyrimidin-2-yl)-1-(4-fluorophenyl)ethanone |
| SMILES | Cc1cnc(CC(=O)c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C14H13FN2O/c1-9-8-16-14(17-10(9)2)7-13(18)11-3-5-12(15)6-4-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | MXXXTYCAESZSIY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |