C22H24N4 — CID 174663749
6-[4-(1-aminocyclobutyl)phenyl]-2-(aminomethyl)-5-phenylpyridin-3-amine (PubChem CID 174663749) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-[4-(1-aminocyclobutyl)phenyl]-2-(aminomethyl)-5-phenylpyridin-3-amine.
| Compound Name | 6-[4-(1-aminocyclobutyl)phenyl]-2-(aminomethyl)-5-phenylpyridin-3-amine |
|---|---|
| PubChem CID | 174663749 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 6-[4-(1-aminocyclobutyl)phenyl]-2-(aminomethyl)-5-phenylpyridin-3-amine |
| SMILES | NCc1nc(-c2ccc(C3(N)CCC3)cc2)c(-c2ccccc2)cc1N |
| InChI | InChI=1S/C22H24N4/c23-14-20-19(24)13-18(15-5-2-1-3-6-15)21(26-20)16-7-9-17(10-8-16)22(25)11-4-12-22/h1-3,5-10,13H,4,11-12,14,23-25H2 |
| InChIKey | WBKHVDHSGPXOJV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |