C27H27N5 — CID 89044335
1-[4-[6-(1-amino-3-iminopropan-2-yl)-3-phenyl-1,5-naphthyridin-2-yl]phenyl]cyclobutan-1-amine (PubChem CID 89044335) has the molecular formula C27H27N5 and a molecular weight of 421.55 g/mol. Its IUPAC name is 1-[4-[6-(1-amino-3-iminopropan-2-yl)-3-phenyl-1,5-naphthyridin-2-yl]phenyl]cyclobutan-1-amine.
| Compound Name | 1-[4-[6-(1-amino-3-iminopropan-2-yl)-3-phenyl-1,5-naphthyridin-2-yl]phenyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 89044335 |
| Molecular Formula | C27H27N5 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-[4-[6-(1-amino-3-iminopropan-2-yl)-3-phenyl-1,5-naphthyridin-2-yl]phenyl]cyclobutan-1-amine |
| SMILES | [H]/N=C/C(CN)c1ccc2nc(-c3ccc(C4(N)CCC4)cc3)c(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C27H27N5/c28-16-20(17-29)23-11-12-24-25(31-23)15-22(18-5-2-1-3-6-18)26(32-24)19-7-9-21(10-8-19)27(30)13-4-14-27/h1-3,5-12,15-16,20,28H,4,13-14,17,29-30H2/b28-16+ |
| InChIKey | OTQSLFHJEOMVMX-LQKURTRISA-N |
| XLogP | 4.99 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|