C20H17FN2O3 — CID 174667318
6-fluoro-4-oxo-1-[4-(4-oxobutan-2-yl)phenyl]quinoline-3-carboxamide (PubChem CID 174667318) has the molecular formula C20H17FN2O3 and a molecular weight of 352.37 g/mol. Its IUPAC name is 6-fluoro-4-oxo-1-[4-(4-oxobutan-2-yl)phenyl]quinoline-3-carboxamide.
| Compound Name | 6-fluoro-4-oxo-1-[4-(4-oxobutan-2-yl)phenyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 174667318 |
| Molecular Formula | C20H17FN2O3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 6-fluoro-4-oxo-1-[4-(4-oxobutan-2-yl)phenyl]quinoline-3-carboxamide |
| SMILES | CC(CC=O)c1ccc(-n2cc(C(N)=O)c(=O)c3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C20H17FN2O3/c1-12(8-9-24)13-2-5-15(6-3-13)23-11-17(20(22)26)19(25)16-10-14(21)4-7-18(16)23/h2-7,9-12H,8H2,1H3,(H2,22,26) |
| InChIKey | BRFXEYSHLYQZDC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|