C24H38N2O2S — CID 174667593
[4-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174667593) has the molecular formula C24H38N2O2S and a molecular weight of 418.65 g/mol. Its IUPAC name is [4-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174667593 |
| Molecular Formula | C24H38N2O2S |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [4-[4-(8-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC1CCCC2CCC(c3csc(C4CCN(OC(=O)C(C)(C)C)CC4)n3)CC12 |
| InChI | InChI=1S/C24H38N2O2S/c1-16-6-5-7-17-8-9-19(14-20(16)17)21-15-29-22(25-21)18-10-12-26(13-11-18)28-23(27)24(2,3)4/h15-20H,5-14H2,1-4H3 |
| InChIKey | DEFKWQYEIABNNA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |