C24H23F3N2OS — CID 174670841
N-[3-amino-4-(4-butylphenyl)sulfanylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 174670841) has the molecular formula C24H23F3N2OS and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[3-amino-4-(4-butylphenyl)sulfanylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-amino-4-(4-butylphenyl)sulfanylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174670841 |
| Molecular Formula | C24H23F3N2OS |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | N-[3-amino-4-(4-butylphenyl)sulfanylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CCCCc1ccc(Sc2ccc(NC(=O)c3cccc(C(F)(F)F)c3)cc2N)cc1 |
| InChI | InChI=1S/C24H23F3N2OS/c1-2-3-5-16-8-11-20(12-9-16)31-22-13-10-19(15-21(22)28)29-23(30)17-6-4-7-18(14-17)24(25,26)27/h4,6-15H,2-3,5,28H2,1H3,(H,29,30) |
| InChIKey | FZSWTDMOQDBJED-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|