C22H20F3N3OS — CID 67040753
N-[3-amino-4-[4-(dimethylamino)phenyl]sulfanylphenyl]-3-(trifluoromethyl)benzamide (PubChem CID 67040753) has the molecular formula C22H20F3N3OS and a molecular weight of 431.48 g/mol. Its IUPAC name is N-[3-amino-4-[4-(dimethylamino)phenyl]sulfanylphenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-amino-4-[4-(dimethylamino)phenyl]sulfanylphenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67040753 |
| Molecular Formula | C22H20F3N3OS |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-[3-amino-4-[4-(dimethylamino)phenyl]sulfanylphenyl]-3-(trifluoromethyl)benzamide |
| SMILES | CN(C)c1ccc(Sc2ccc(NC(=O)c3cccc(C(F)(F)F)c3)cc2N)cc1 |
| InChI | InChI=1S/C22H20F3N3OS/c1-28(2)17-7-9-18(10-8-17)30-20-11-6-16(13-19(20)26)27-21(29)14-4-3-5-15(12-14)22(23,24)25/h3-13H,26H2,1-2H3,(H,27,29) |
| InChIKey | VBYZVLKPNORUBJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|