C24H24Cl2N4O3S — CID 67040605
2,2-dichloroethyl N-[4-[2-amino-4-[[3-(dimethylamino)benzoyl]amino]phenyl]sulfanylphenyl]carbamate (PubChem CID 67040605) has the molecular formula C24H24Cl2N4O3S and a molecular weight of 519.45 g/mol. Its IUPAC name is 2,2-dichloroethyl N-[4-[2-amino-4-[[3-(dimethylamino)benzoyl]amino]phenyl]sulfanylphenyl]carbamate.
| Compound Name | 2,2-dichloroethyl N-[4-[2-amino-4-[[3-(dimethylamino)benzoyl]amino]phenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 67040605 |
| Molecular Formula | C24H24Cl2N4O3S |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 2,2-dichloroethyl N-[4-[2-amino-4-[[3-(dimethylamino)benzoyl]amino]phenyl]sulfanylphenyl]carbamate |
| SMILES | CN(C)c1cccc(C(=O)Nc2ccc(Sc3ccc(NC(=O)OCC(Cl)Cl)cc3)c(N)c2)c1 |
| InChI | InChI=1S/C24H24Cl2N4O3S/c1-30(2)18-5-3-4-15(12-18)23(31)28-17-8-11-21(20(27)13-17)34-19-9-6-16(7-10-19)29-24(32)33-14-22(25)26/h3-13,22H,14,27H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | RISQYVVWXOWCGT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|