C25H31N3O5S — CID 174671175
3-[[4-[5-[(3,4-diethoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]propane-1-sulfinic acid (PubChem CID 174671175) has the molecular formula C25H31N3O5S and a molecular weight of 485.61 g/mol. Its IUPAC name is 3-[[4-[5-[(3,4-diethoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]propane-1-sulfinic acid.
| Compound Name | 3-[[4-[5-[(3,4-diethoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]propane-1-sulfinic acid |
|---|---|
| PubChem CID | 174671175 |
| Molecular Formula | C25H31N3O5S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-[[4-[5-[(3,4-diethoxyphenyl)methyl]-1,2,4-oxadiazol-3-yl]-2,3-dihydro-1H-inden-1-yl]amino]propane-1-sulfinic acid |
| SMILES | CCOc1ccc(Cc2nc(-c3cccc4c3CCC4NCCCS(=O)O)no2)cc1OCC |
| InChI | InChI=1S/C25H31N3O5S/c1-3-31-22-12-9-17(15-23(22)32-4-2)16-24-27-25(28-33-24)20-8-5-7-19-18(20)10-11-21(19)26-13-6-14-34(29)30/h5,7-9,12,15,21,26H,3-4,6,10-11,13-14,16H2,1-2H3,(H,29,30) |
| InChIKey | RMEIBKBBDQRLIP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|