About phenol;thiophene;triethyl(formyl)phosphanium
phenol;thiophene;triethyl(formyl)phosphanium (PubChem CID 174671826) has the molecular formula C17H26O2PS+
and a molecular weight of 325.43 g/mol. Its IUPAC name is phenol;thiophene;triethyl(formyl)phosphanium.
Molecular Properties
| Compound Name | phenol;thiophene;triethyl(formyl)phosphanium |
| PubChem CID | 174671826 |
| Molecular Formula | C17H26O2PS+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | phenol;thiophene;triethyl(formyl)phosphanium |
| SMILES | CC[P+](C=O)(CC)CC.Oc1ccccc1.c1ccsc1 |
| InChI | InChI=1S/C7H16OP.C6H6O.C4H4S/c1-4-9(5-2,6-3)7-8;7-6-4-2-1-3-5-6;1-2-4-5-3-1/h7H,4-6H2,1-3H3;1-5,7H;1-4H/q+1;; |
| InChIKey | JGAKXMYDRDIQRJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenol;thiophene;triethyl(formyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;thiophene;triethyl(formyl)phosphanium?
The IUPAC name of phenol;thiophene;triethyl(formyl)phosphanium (CID 174671826) is phenol;thiophene;triethyl(formyl)phosphanium.
What is the SMILES notation for phenol;thiophene;triethyl(formyl)phosphanium?
The canonical SMILES for phenol;thiophene;triethyl(formyl)phosphanium is CC[P+](C=O)(CC)CC.Oc1ccccc1.c1ccsc1.
What is the InChIKey of phenol;thiophene;triethyl(formyl)phosphanium?
The InChIKey is JGAKXMYDRDIQRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OP.C6H6O.C4H4S/c1-4-9(5-2,6-3)7-8;7-6-4-2-1-3-5-6;1-2-4-5-3-1/h7H,4-6H2,1-3H3;1-5,7H;1-4H/q+1;;.
What are the key properties of phenol;thiophene;triethyl(formyl)phosphanium?
phenol;thiophene;triethyl(formyl)phosphanium has a molecular weight of 325.43 g/mol, XLogP of 5.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;thiophene;triethyl(formyl)phosphanium is sourced from PubChem (CID 174671826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).