C9H23NO2Si — CID 174672141
1-(dimethoxymethylsilyl)-3,3-dimethylbutan-1-amine (PubChem CID 174672141) has the molecular formula C9H23NO2Si and a molecular weight of 205.37 g/mol. Its IUPAC name is 1-(dimethoxymethylsilyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 1-(dimethoxymethylsilyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 174672141 |
| Molecular Formula | C9H23NO2Si |
| Molecular Weight | 205.37 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(dimethoxymethylsilyl)-3,3-dimethylbutan-1-amine |
| SMILES | COC(OC)[SiH2]C(N)CC(C)(C)C |
| InChI | InChI=1S/C9H23NO2Si/c1-9(2,3)6-7(10)13-8(11-4)12-5/h7-8H,6,10,13H2,1-5H3 |
| InChIKey | QKTXIVHCPZNJNE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|