C9H20O4Si — CID 150643555
dimethoxymethylsilylmethyl 2,2-dimethylpropanoate (PubChem CID 150643555) has the molecular formula C9H20O4Si and a molecular weight of 220.34 g/mol. Its IUPAC name is dimethoxymethylsilylmethyl 2,2-dimethylpropanoate.
| Compound Name | dimethoxymethylsilylmethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 150643555 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | dimethoxymethylsilylmethyl 2,2-dimethylpropanoate |
| SMILES | COC(OC)[SiH2]COC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H20O4Si/c1-9(2,3)7(10)13-6-14-8(11-4)12-5/h8H,6,14H2,1-5H3 |
| InChIKey | JAKGLMAHTDHIIA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|