C17H34O9Si2 — CID 173132683
dimethoxymethylsilylmethyl 2-methylprop-2-enoate;2-trimethoxysilylethyl 2-methylprop-2-enoate (PubChem CID 173132683) has the molecular formula C17H34O9Si2 and a molecular weight of 438.62 g/mol. Its IUPAC name is dimethoxymethylsilylmethyl 2-methylprop-2-enoate;2-trimethoxysilylethyl 2-methylprop-2-enoate.
| Compound Name | dimethoxymethylsilylmethyl 2-methylprop-2-enoate;2-trimethoxysilylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173132683 |
| Molecular Formula | C17H34O9Si2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | dimethoxymethylsilylmethyl 2-methylprop-2-enoate;2-trimethoxysilylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[Si](OC)(OC)OC.C=C(C)C(=O)OC[SiH2]C(OC)OC |
| InChI | InChI=1S/C9H18O5Si.C8H16O4Si/c1-8(2)9(10)14-6-7-15(11-3,12-4)13-5;1-6(2)7(9)12-5-13-8(10-3)11-4/h1,6-7H2,2-5H3;8H,1,5,13H2,2-4H3 |
| InChIKey | GPXMKUPCXNWWJK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|