C8H6N2O3 — CID 174672800
6-hydroxy-1,3-benzoxazole-5-carboxamide (PubChem CID 174672800) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 6-hydroxy-1,3-benzoxazole-5-carboxamide.
| Compound Name | 6-hydroxy-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 174672800 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 6-hydroxy-1,3-benzoxazole-5-carboxamide |
| SMILES | NC(=O)c1cc2ncoc2cc1O |
| InChI | InChI=1S/C8H6N2O3/c9-8(12)4-1-5-7(2-6(4)11)13-3-10-5/h1-3,11H,(H2,9,12) |
| InChIKey | OFHJUSPRIQNPKC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |