C8H4ClNO3 — CID 83880227
5-chloro-1,3-benzoxazole-6-carboxylic acid (PubChem CID 83880227) has the molecular formula C8H4ClNO3 and a molecular weight of 197.58 g/mol. Its IUPAC name is 5-chloro-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 5-chloro-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 83880227 |
| Molecular Formula | C8H4ClNO3 |
| Molecular Weight | 197.58 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 5-chloro-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1cc2ocnc2cc1Cl |
| InChI | InChI=1S/C8H4ClNO3/c9-5-2-6-7(13-3-10-6)1-4(5)8(11)12/h1-3H,(H,11,12) |
| InChIKey | UQQNNHOPGDRNKE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |