C23H19ClN4 — CID 174673008
1,1'-biphenyl;2-naphthalen-1-yltetrazole;hydrochloride (PubChem CID 174673008) has the molecular formula C23H19ClN4 and a molecular weight of 386.89 g/mol. Its IUPAC name is 1,1'-biphenyl;2-naphthalen-1-yltetrazole;hydrochloride.
| Compound Name | 1,1'-biphenyl;2-naphthalen-1-yltetrazole;hydrochloride |
|---|---|
| PubChem CID | 174673008 |
| Molecular Formula | C23H19ClN4 |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1,1'-biphenyl;2-naphthalen-1-yltetrazole;hydrochloride |
| SMILES | Cl.c1ccc(-c2ccccc2)cc1.c1ccc2c(-n3ncnn3)cccc2c1 |
| InChI | InChI=1S/C12H10.C11H8N4.ClH/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-9(4-1)5-3-7-11(10)15-13-8-12-14-15;/h1-10H;1-8H;1H |
| InChIKey | YCPLDVOUSLDWMC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |