About lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride
lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride (PubChem CID 174674138) has the molecular formula C7H9LiN2O2
and a molecular weight of 160.10 g/mol. Its IUPAC name is lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride.
Molecular Properties
| Compound Name | lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride |
| PubChem CID | 174674138 |
| Molecular Formula | C7H9LiN2O2 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride |
| SMILES | O=C(O)c1cn2c(n1)CCC2.[H-].[Li+] |
| InChI | InChI=1S/C7H8N2O2.Li.H/c10-7(11)5-4-9-3-1-2-6(9)8-5;;/h4H,1-3H2,(H,10,11);;/q;+1;-1 |
| InChIKey | OUAJNXGACUHLNF-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride?
The IUPAC name of lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride (CID 174674138) is lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride.
What is the SMILES notation for lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride?
The canonical SMILES for lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride is O=C(O)c1cn2c(n1)CCC2.[H-].[Li+].
What is the InChIKey of lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride?
The InChIKey is OUAJNXGACUHLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.Li.H/c10-7(11)5-4-9-3-1-2-6(9)8-5;;/h4H,1-3H2,(H,10,11);;/q;+1;-1.
What are the key properties of lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride?
lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride has a molecular weight of 160.10 g/mol, XLogP of -2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;6,7-dihydro-5H-pyrrolo[1,2-a]imidazole-2-carboxylic acid;hydride is sourced from PubChem (CID 174674138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).