C14H13ClN2O4 — CID 17467699
N'-[2-(2-chlorophenoxy)acetyl]-5-methylfuran-2-carbohydrazide (PubChem CID 17467699) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is N'-[2-(2-chlorophenoxy)acetyl]-5-methylfuran-2-carbohydrazide.
| Compound Name | N'-[2-(2-chlorophenoxy)acetyl]-5-methylfuran-2-carbohydrazide |
|---|---|
| PubChem CID | 17467699 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N'-[2-(2-chlorophenoxy)acetyl]-5-methylfuran-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)COc2ccccc2Cl)o1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-9-6-7-12(21-9)14(19)17-16-13(18)8-20-11-5-3-2-4-10(11)15/h2-7H,8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | MBVJHFWWZDOFRN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|