About bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate
bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate (PubChem CID 174679537) has the molecular formula C40H26NO4S3-
and a molecular weight of 680.85 g/mol. Its IUPAC name is bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate.
Molecular Properties
| Compound Name | bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate |
| PubChem CID | 174679537 |
| Molecular Formula | C40H26NO4S3- |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.10 |
| IUPAC Name | bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate |
| SMILES | O=[N+]([O-])c1ccc2cc(-c3c4ccccc4c(S(=O)[O-])c4ccccc34)ccc2c1.c1ccc2sccc2c1.c1ccc2sccc2c1 |
| InChI | InChI=1S/C24H15NO4S.2C8H6S/c26-25(27)18-12-11-15-13-17(10-9-16(15)14-18)23-19-5-1-3-7-21(19)24(30(28)29)22-8-4-2-6-20(22)23;2*1-2-4-8-7(3-1)5-6-9-8/h1-14H,(H,28,29);2*1-6H/p-1 |
| InChIKey | NFSHUPHMCYNHJW-UHFFFAOYSA-M |
| XLogP | 11.76 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate?
The IUPAC name of bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate (CID 174679537) is bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate.
What is the SMILES notation for bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate?
The canonical SMILES for bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate is O=[N+]([O-])c1ccc2cc(-c3c4ccccc4c(S(=O)[O-])c4ccccc34)ccc2c1.c1ccc2sccc2c1.c1ccc2sccc2c1.
What is the InChIKey of bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate?
The InChIKey is NFSHUPHMCYNHJW-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H15NO4S.2C8H6S/c26-25(27)18-12-11-15-13-17(10-9-16(15)14-18)23-19-5-1-3-7-21(19)24(30(28)29)22-8-4-2-6-20(22)23;2*1-2-4-8-7(3-1)5-6-9-8/h1-14H,(H,28,29);2*1-6H/p-1.
What are the key properties of bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate?
bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate has a molecular weight of 680.85 g/mol, XLogP of 11.76, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-benzothiophene);10-(6-nitronaphthalen-2-yl)anthracene-9-sulfinate is sourced from PubChem (CID 174679537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).