C28H44O3 — CID 174680295
5-methylbicyclo[2.2.1]hept-2-ene;4-[(4-methylphenyl)methoxy]dodecanoic acid (PubChem CID 174680295) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is 5-methylbicyclo[2.2.1]hept-2-ene;4-[(4-methylphenyl)methoxy]dodecanoic acid.
| Compound Name | 5-methylbicyclo[2.2.1]hept-2-ene;4-[(4-methylphenyl)methoxy]dodecanoic acid |
|---|---|
| PubChem CID | 174680295 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | 5-methylbicyclo[2.2.1]hept-2-ene;4-[(4-methylphenyl)methoxy]dodecanoic acid |
| SMILES | CC1CC2C=CC1C2.CCCCCCCCC(CCC(=O)O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C20H32O3.C8H12/c1-3-4-5-6-7-8-9-19(14-15-20(21)22)23-16-18-12-10-17(2)11-13-18;1-6-4-7-2-3-8(6)5-7/h10-13,19H,3-9,14-16H2,1-2H3,(H,21,22);2-3,6-8H,4-5H2,1H3 |
| InChIKey | WKLUQNBGTZPVML-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|