C11H18N4O4 — CID 174680348
2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-1,2,4-triazol-3-yl]ethyl formate (PubChem CID 174680348) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-1,2,4-triazol-3-yl]ethyl formate.
| Compound Name | 2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-1,2,4-triazol-3-yl]ethyl formate |
|---|---|
| PubChem CID | 174680348 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1H-1,2,4-triazol-3-yl]ethyl formate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(CCOC=O)n[nH]1 |
| InChI | InChI=1S/C11H18N4O4/c1-11(2,3)19-10(17)12-6-9-13-8(14-15-9)4-5-18-7-16/h7H,4-6H2,1-3H3,(H,12,17)(H,13,14,15) |
| InChIKey | CZRSUJXOYFUASI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|