C28H32ClNO4 — CID 174680692
2-butoxy-2-[1-(4-chlorophenyl)-3-methyl-4-(morpholin-4-ylmethyl)naphthalen-2-yl]acetic acid (PubChem CID 174680692) has the molecular formula C28H32ClNO4 and a molecular weight of 482.02 g/mol. Its IUPAC name is 2-butoxy-2-[1-(4-chlorophenyl)-3-methyl-4-(morpholin-4-ylmethyl)naphthalen-2-yl]acetic acid.
| Compound Name | 2-butoxy-2-[1-(4-chlorophenyl)-3-methyl-4-(morpholin-4-ylmethyl)naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 174680692 |
| Molecular Formula | C28H32ClNO4 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-butoxy-2-[1-(4-chlorophenyl)-3-methyl-4-(morpholin-4-ylmethyl)naphthalen-2-yl]acetic acid |
| SMILES | CCCCOC(C(=O)O)c1c(C)c(CN2CCOCC2)c2ccccc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H32ClNO4/c1-3-4-15-34-27(28(31)32)25-19(2)24(18-30-13-16-33-17-14-30)22-7-5-6-8-23(22)26(25)20-9-11-21(29)12-10-20/h5-12,27H,3-4,13-18H2,1-2H3,(H,31,32) |
| InChIKey | CDSXUFQAFXYNSJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|