C19H34N4O — CID 174680889
bis[(2R)-4-cyclobutyl-2-methylpiperazin-1-yl]methanone (PubChem CID 174680889) has the molecular formula C19H34N4O and a molecular weight of 334.51 g/mol. Its IUPAC name is bis[(2R)-4-cyclobutyl-2-methylpiperazin-1-yl]methanone.
| Compound Name | bis[(2R)-4-cyclobutyl-2-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 174680889 |
| Molecular Formula | C19H34N4O |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | bis[(2R)-4-cyclobutyl-2-methylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C2CCC2)CCN1C(=O)N1CCN(C2CCC2)C[C@H]1C |
| InChI | InChI=1S/C19H34N4O/c1-15-13-20(17-5-3-6-17)9-11-22(15)19(24)23-12-10-21(14-16(23)2)18-7-4-8-18/h15-18H,3-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | PEJCTWRHUDVHDB-HZPDHXFCSA-N |
| XLogP | 2.22 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |